C30H29N3O — CID 68766101
3-[(2,5-dimethylpyrazol-3-yl)methylidene]-1-tritylpiperidin-4-one (PubChem CID 68766101) has the molecular formula C30H29N3O and a molecular weight of 447.58 g/mol. Its IUPAC name is 3-[(2,5-dimethylpyrazol-3-yl)methylidene]-1-tritylpiperidin-4-one.
| Compound Name | 3-[(2,5-dimethylpyrazol-3-yl)methylidene]-1-tritylpiperidin-4-one |
|---|---|
| PubChem CID | 68766101 |
| Molecular Formula | C30H29N3O |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 3-[(2,5-dimethylpyrazol-3-yl)methylidene]-1-tritylpiperidin-4-one |
| SMILES | Cc1cc(C=C2CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CCC2=O)n(C)n1 |
| InChI | InChI=1S/C30H29N3O/c1-23-20-28(32(2)31-23)21-24-22-33(19-18-29(24)34)30(25-12-6-3-7-13-25,26-14-8-4-9-15-26)27-16-10-5-11-17-27/h3-17,20-21H,18-19,22H2,1-2H3 |
| InChIKey | IZZJKJJZMWXLKX-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|