C29H27N3O — CID 68764549
(3Z)-3-[(1-methylpyrazol-3-yl)methylidene]-1-tritylpiperidin-4-one (PubChem CID 68764549) has the molecular formula C29H27N3O and a molecular weight of 433.56 g/mol. Its IUPAC name is (3Z)-3-[(1-methylpyrazol-3-yl)methylidene]-1-tritylpiperidin-4-one.
| Compound Name | (3Z)-3-[(1-methylpyrazol-3-yl)methylidene]-1-tritylpiperidin-4-one |
|---|---|
| PubChem CID | 68764549 |
| Molecular Formula | C29H27N3O |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | (3Z)-3-[(1-methylpyrazol-3-yl)methylidene]-1-tritylpiperidin-4-one |
| SMILES | Cn1ccc(/C=C2/CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CCC2=O)n1 |
| InChI | InChI=1S/C29H27N3O/c1-31-19-17-27(30-31)21-23-22-32(20-18-28(23)33)29(24-11-5-2-6-12-24,25-13-7-3-8-14-25)26-15-9-4-10-16-26/h2-17,19,21H,18,20,22H2,1H3/b23-21- |
| InChIKey | UOVPMOGKEQMHAE-LNVKXUELSA-N |
| XLogP | 5.07 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|