C32H32N4O3 — CID 23138471
tert-butyl 3-[(E)-(4-oxo-1-tritylpiperidin-3-ylidene)methyl]-1,2,4-triazole-1-carboxylate (PubChem CID 23138471) has the molecular formula C32H32N4O3 and a molecular weight of 520.63 g/mol. Its IUPAC name is tert-butyl 3-[(E)-(4-oxo-1-tritylpiperidin-3-ylidene)methyl]-1,2,4-triazole-1-carboxylate.
| Compound Name | tert-butyl 3-[(E)-(4-oxo-1-tritylpiperidin-3-ylidene)methyl]-1,2,4-triazole-1-carboxylate |
|---|---|
| PubChem CID | 23138471 |
| Molecular Formula | C32H32N4O3 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | tert-butyl 3-[(E)-(4-oxo-1-tritylpiperidin-3-ylidene)methyl]-1,2,4-triazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cnc(/C=C2\CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CCC2=O)n1 |
| InChI | InChI=1S/C32H32N4O3/c1-31(2,3)39-30(38)36-23-33-29(34-36)21-24-22-35(20-19-28(24)37)32(25-13-7-4-8-14-25,26-15-9-5-10-16-26)27-17-11-6-12-18-27/h4-18,21,23H,19-20,22H2,1-3H3/b24-21+ |
| InChIKey | BIYIYPWKHUVCRI-DARPEHSRSA-N |
| XLogP | 5.71 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|