C35H37N3O3 — CID 69024699
tert-butyl 3-[(3E)-3-(4-oxo-1-tritylpiperidin-3-ylidene)propyl]pyrazole-1-carboxylate (PubChem CID 69024699) has the molecular formula C35H37N3O3 and a molecular weight of 547.70 g/mol. Its IUPAC name is tert-butyl 3-[(3E)-3-(4-oxo-1-tritylpiperidin-3-ylidene)propyl]pyrazole-1-carboxylate.
| Compound Name | tert-butyl 3-[(3E)-3-(4-oxo-1-tritylpiperidin-3-ylidene)propyl]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 69024699 |
| Molecular Formula | C35H37N3O3 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | tert-butyl 3-[(3E)-3-(4-oxo-1-tritylpiperidin-3-ylidene)propyl]pyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ccc(CC/C=C2\CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CCC2=O)n1 |
| InChI | InChI=1S/C35H37N3O3/c1-34(2,3)41-33(40)38-25-22-31(36-38)21-13-14-27-26-37(24-23-32(27)39)35(28-15-7-4-8-16-28,29-17-9-5-10-18-29)30-19-11-6-12-20-30/h4-12,14-20,22,25H,13,21,23-24,26H2,1-3H3/b27-14+ |
| InChIKey | KEPHUINKPFBINB-MZJWZYIUSA-N |
| XLogP | 6.79 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|