C35H37N3O3S — CID 86609408
tert-butyl 3-[(E)-(4-acetylsulfanyl-1-tritylpiperidin-3-ylidene)methyl]pyrazole-1-carboxylate (PubChem CID 86609408) has the molecular formula C35H37N3O3S and a molecular weight of 579.77 g/mol. Its IUPAC name is tert-butyl 3-[(E)-(4-acetylsulfanyl-1-tritylpiperidin-3-ylidene)methyl]pyrazole-1-carboxylate.
| Compound Name | tert-butyl 3-[(E)-(4-acetylsulfanyl-1-tritylpiperidin-3-ylidene)methyl]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 86609408 |
| Molecular Formula | C35H37N3O3S |
| Molecular Weight | 579.77 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | tert-butyl 3-[(E)-(4-acetylsulfanyl-1-tritylpiperidin-3-ylidene)methyl]pyrazole-1-carboxylate |
| SMILES | CC(=O)SC1CCN(C(c2ccccc2)(c2ccccc2)c2ccccc2)C/C1=C\c1ccn(C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C35H37N3O3S/c1-26(39)42-32-21-22-37(25-27(32)24-31-20-23-38(36-31)33(40)41-34(2,3)4)35(28-14-8-5-9-15-28,29-16-10-6-11-17-29)30-18-12-7-13-19-30/h5-20,23-24,32H,21-22,25H2,1-4H3/b27-24+ |
| InChIKey | UGVYYSDXHNKLND-SOYKGTTHSA-N |
| XLogP | 7.40 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.77 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|