C37H41N3O5 — CID 23138533
tert-butyl 5-(2-ethoxy-2-oxoethyl)-3-[(E)-(4-hydroxy-1-tritylpiperidin-3-ylidene)methyl]pyrazole-1-carboxylate (PubChem CID 23138533) has the molecular formula C37H41N3O5 and a molecular weight of 607.75 g/mol. Its IUPAC name is tert-butyl 5-(2-ethoxy-2-oxoethyl)-3-[(E)-(4-hydroxy-1-tritylpiperidin-3-ylidene)methyl]pyrazole-1-carboxylate.
| Compound Name | tert-butyl 5-(2-ethoxy-2-oxoethyl)-3-[(E)-(4-hydroxy-1-tritylpiperidin-3-ylidene)methyl]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 23138533 |
| Molecular Formula | C37H41N3O5 |
| Molecular Weight | 607.75 g/mol |
| Exact Mass | 607.30 |
| IUPAC Name | tert-butyl 5-(2-ethoxy-2-oxoethyl)-3-[(E)-(4-hydroxy-1-tritylpiperidin-3-ylidene)methyl]pyrazole-1-carboxylate |
| SMILES | CCOC(=O)Cc1cc(/C=C2\CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CCC2O)nn1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H41N3O5/c1-5-44-34(42)25-32-24-31(38-40(32)35(43)45-36(2,3)4)23-27-26-39(22-21-33(27)41)37(28-15-9-6-10-16-28,29-17-11-7-12-18-29)30-19-13-8-14-20-30/h6-20,23-24,33,41H,5,21-22,25-26H2,1-4H3/b27-23+ |
| InChIKey | SQNZDZSXLCILNJ-SLEBQGDGSA-N |
| XLogP | 6.21 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.75 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|