C32H35N5O3 — CID 68766284
ethyl 4-[5-[(Z)-(4-hydroxy-1-tritylpiperidin-3-ylidene)methyl]tetrazol-2-yl]butanoate (PubChem CID 68766284) has the molecular formula C32H35N5O3 and a molecular weight of 537.66 g/mol. Its IUPAC name is ethyl 4-[5-[(Z)-(4-hydroxy-1-tritylpiperidin-3-ylidene)methyl]tetrazol-2-yl]butanoate.
| Compound Name | ethyl 4-[5-[(Z)-(4-hydroxy-1-tritylpiperidin-3-ylidene)methyl]tetrazol-2-yl]butanoate |
|---|---|
| PubChem CID | 68766284 |
| Molecular Formula | C32H35N5O3 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | ethyl 4-[5-[(Z)-(4-hydroxy-1-tritylpiperidin-3-ylidene)methyl]tetrazol-2-yl]butanoate |
| SMILES | CCOC(=O)CCCn1nnc(/C=C2/CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CCC2O)n1 |
| InChI | InChI=1S/C32H35N5O3/c1-2-40-31(39)19-12-21-37-34-30(33-35-37)23-25-24-36(22-20-29(25)38)32(26-13-6-3-7-14-26,27-15-8-4-9-16-27)28-17-10-5-11-18-28/h3-11,13-18,23,29,38H,2,12,19-22,24H2,1H3/b25-23- |
| InChIKey | MBUDZXRQWNRZAU-BZZOAKBMSA-N |
| XLogP | 4.46 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|