C32H33N3O3 — CID 68766794
ethyl 2-[4-[(Z)-(4-hydroxy-1-tritylpiperidin-3-ylidene)methyl]pyrazol-1-yl]acetate (PubChem CID 68766794) has the molecular formula C32H33N3O3 and a molecular weight of 507.63 g/mol. Its IUPAC name is ethyl 2-[4-[(Z)-(4-hydroxy-1-tritylpiperidin-3-ylidene)methyl]pyrazol-1-yl]acetate.
| Compound Name | ethyl 2-[4-[(Z)-(4-hydroxy-1-tritylpiperidin-3-ylidene)methyl]pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 68766794 |
| Molecular Formula | C32H33N3O3 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | ethyl 2-[4-[(Z)-(4-hydroxy-1-tritylpiperidin-3-ylidene)methyl]pyrazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1cc(/C=C2/CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CCC2O)cn1 |
| InChI | InChI=1S/C32H33N3O3/c1-2-38-31(37)24-35-22-25(21-33-35)20-26-23-34(19-18-30(26)36)32(27-12-6-3-7-13-27,28-14-8-4-9-15-28)29-16-10-5-11-17-29/h3-17,20-22,30,36H,2,18-19,23-24H2,1H3/b26-20- |
| InChIKey | AIGFZTPYTUNQTE-QOMWVZHYSA-N |
| XLogP | 4.89 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|