C34H38ClN3O3 — CID 162313785
ethyl 4-[4-[(E)-(4-hydroxy-1-tritylpiperidin-3-ylidene)methyl]pyrazol-1-yl]butanoate;hydrochloride (PubChem CID 162313785) has the molecular formula C34H38ClN3O3 and a molecular weight of 572.15 g/mol. Its IUPAC name is ethyl 4-[4-[(E)-(4-hydroxy-1-tritylpiperidin-3-ylidene)methyl]pyrazol-1-yl]butanoate;hydrochloride.
| Compound Name | ethyl 4-[4-[(E)-(4-hydroxy-1-tritylpiperidin-3-ylidene)methyl]pyrazol-1-yl]butanoate;hydrochloride |
|---|---|
| PubChem CID | 162313785 |
| Molecular Formula | C34H38ClN3O3 |
| Molecular Weight | 572.15 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | ethyl 4-[4-[(E)-(4-hydroxy-1-tritylpiperidin-3-ylidene)methyl]pyrazol-1-yl]butanoate;hydrochloride |
| SMILES | CCOC(=O)CCCn1cc(/C=C2\CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CCC2O)cn1.Cl |
| InChI | InChI=1S/C34H37N3O3.ClH/c1-2-40-33(39)19-12-21-37-25-27(24-35-37)23-28-26-36(22-20-32(28)38)34(29-13-6-3-7-14-29,30-15-8-4-9-16-30)31-17-10-5-11-18-31;/h3-11,13-18,23-25,32,38H,2,12,19-22,26H2,1H3;1H/b28-23+; |
| InChIKey | MAGLFHWTNRLUNB-XVBNZNTOSA-N |
| XLogP | 6.09 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.15 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|