C34H40N2O3 — CID 69024208
ethyl 1-[(2Z)-2-(4-hydroxy-1-tritylpiperidin-3-ylidene)ethyl]piperidine-4-carboxylate (PubChem CID 69024208) has the molecular formula C34H40N2O3 and a molecular weight of 524.71 g/mol. Its IUPAC name is ethyl 1-[(2Z)-2-(4-hydroxy-1-tritylpiperidin-3-ylidene)ethyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(2Z)-2-(4-hydroxy-1-tritylpiperidin-3-ylidene)ethyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 69024208 |
| Molecular Formula | C34H40N2O3 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | ethyl 1-[(2Z)-2-(4-hydroxy-1-tritylpiperidin-3-ylidene)ethyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C/C=C2/CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CCC2O)CC1 |
| InChI | InChI=1S/C34H40N2O3/c1-2-39-33(38)27-18-22-35(23-19-27)24-20-28-26-36(25-21-32(28)37)34(29-12-6-3-7-13-29,30-14-8-4-9-15-30)31-16-10-5-11-17-31/h3-17,20,27,32,37H,2,18-19,21-26H2,1H3/b28-20- |
| InChIKey | PPPMFXUHANQNCC-RRAHZORUSA-N |
| XLogP | 5.25 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|