C29H31NO5S — CID 91388825
ethyl 2-(4-methylsulfonyloxy-1-tritylpiperidin-3-ylidene)acetate (PubChem CID 91388825) has the molecular formula C29H31NO5S and a molecular weight of 505.64 g/mol. Its IUPAC name is ethyl 2-(4-methylsulfonyloxy-1-tritylpiperidin-3-ylidene)acetate.
| Compound Name | ethyl 2-(4-methylsulfonyloxy-1-tritylpiperidin-3-ylidene)acetate |
|---|---|
| PubChem CID | 91388825 |
| Molecular Formula | C29H31NO5S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | ethyl 2-(4-methylsulfonyloxy-1-tritylpiperidin-3-ylidene)acetate |
| SMILES | CCOC(=O)C=C1CN(C(c2ccccc2)(c2ccccc2)c2ccccc2)CCC1OS(C)(=O)=O |
| InChI | InChI=1S/C29H31NO5S/c1-3-34-28(31)21-23-22-30(20-19-27(23)35-36(2,32)33)29(24-13-7-4-8-14-24,25-15-9-5-10-16-25)26-17-11-6-12-18-26/h4-18,21,27H,3,19-20,22H2,1-2H3 |
| InChIKey | KAVBFIHNHPFKKT-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|