C34H35N3O3S — CID 91456641
ethyl 1-[2-(4-acetylsulfanyl-1-tritylpiperidin-3-ylidene)ethyl]pyrazole-4-carboxylate (PubChem CID 91456641) has the molecular formula C34H35N3O3S and a molecular weight of 565.74 g/mol. Its IUPAC name is ethyl 1-[2-(4-acetylsulfanyl-1-tritylpiperidin-3-ylidene)ethyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[2-(4-acetylsulfanyl-1-tritylpiperidin-3-ylidene)ethyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 91456641 |
| Molecular Formula | C34H35N3O3S |
| Molecular Weight | 565.74 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | ethyl 1-[2-(4-acetylsulfanyl-1-tritylpiperidin-3-ylidene)ethyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(CC=C2CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CCC2SC(C)=O)c1 |
| InChI | InChI=1S/C34H35N3O3S/c1-3-40-33(39)28-23-35-37(25-28)22-19-27-24-36(21-20-32(27)41-26(2)38)34(29-13-7-4-8-14-29,30-15-9-5-10-16-30)31-17-11-6-12-18-31/h4-19,23,25,32H,3,20-22,24H2,1-2H3 |
| InChIKey | QZOWNXZNOAGLAW-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.74 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|