C30H28N2O2S — CID 90746473
S-[3-(1,3-oxazol-2-ylmethylidene)-1-tritylpiperidin-4-yl] ethanethioate (PubChem CID 90746473) has the molecular formula C30H28N2O2S and a molecular weight of 480.63 g/mol. Its IUPAC name is S-[3-(1,3-oxazol-2-ylmethylidene)-1-tritylpiperidin-4-yl] ethanethioate.
| Compound Name | S-[3-(1,3-oxazol-2-ylmethylidene)-1-tritylpiperidin-4-yl] ethanethioate |
|---|---|
| PubChem CID | 90746473 |
| Molecular Formula | C30H28N2O2S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | S-[3-(1,3-oxazol-2-ylmethylidene)-1-tritylpiperidin-4-yl] ethanethioate |
| SMILES | CC(=O)SC1CCN(C(c2ccccc2)(c2ccccc2)c2ccccc2)CC1=Cc1ncco1 |
| InChI | InChI=1S/C30H28N2O2S/c1-23(33)35-28-17-19-32(22-24(28)21-29-31-18-20-34-29)30(25-11-5-2-6-12-25,26-13-7-3-8-14-26)27-15-9-4-10-16-27/h2-16,18,20-21,28H,17,19,22H2,1H3 |
| InChIKey | VIYAKTMZZXQKDH-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|