C43H45ClN2O2S2 — CID 157142742
(3E)-3-benzylidene-1-tritylpiperidin-4-ol;S-[(3E)-3-(thiophen-2-ylmethylidene)piperidin-4-yl] ethanethioate;hydrochloride (PubChem CID 157142742) has the molecular formula C43H45ClN2O2S2 and a molecular weight of 721.43 g/mol. Its IUPAC name is (3E)-3-benzylidene-1-tritylpiperidin-4-ol;S-[(3E)-3-(thiophen-2-ylmethylidene)piperidin-4-yl] ethanethioate;hydrochloride.
| Compound Name | (3E)-3-benzylidene-1-tritylpiperidin-4-ol;S-[(3E)-3-(thiophen-2-ylmethylidene)piperidin-4-yl] ethanethioate;hydrochloride |
|---|---|
| PubChem CID | 157142742 |
| Molecular Formula | C43H45ClN2O2S2 |
| Molecular Weight | 721.43 g/mol |
| Exact Mass | 720.26 |
| IUPAC Name | (3E)-3-benzylidene-1-tritylpiperidin-4-ol;S-[(3E)-3-(thiophen-2-ylmethylidene)piperidin-4-yl] ethanethioate;hydrochloride |
| SMILES | CC(=O)SC1CCNC/C1=C\c1cccs1.Cl.OC1CCN(C(c2ccccc2)(c2ccccc2)c2ccccc2)C/C1=C\c1ccccc1 |
| InChI | InChI=1S/C31H29NO.C12H15NOS2.ClH/c33-30-21-22-32(24-26(30)23-25-13-5-1-6-14-25)31(27-15-7-2-8-16-27,28-17-9-3-10-18-28)29-19-11-4-12-20-29;1-9(14)16-12-4-5-13-8-10(12)7-11-3-2-6-15-11;/h1-20,23,30,33H,21-22,24H2;2-3,6-7,12-13H,4-5,8H2,1H3;1H/b26-23+;10-7+; |
| InChIKey | WPRUEBHDEFWFEV-SEOWZXBSSA-N |
| XLogP | 9.32 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.43 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|