C43H45ClN2O3S — CID 159813400
(3E)-3-benzylidene-1-tritylpiperidin-4-ol;S-[(3E)-3-(furan-3-ylmethylidene)piperidin-4-yl] ethanethioate;hydrochloride (PubChem CID 159813400) has the molecular formula C43H45ClN2O3S and a molecular weight of 705.36 g/mol. Its IUPAC name is (3E)-3-benzylidene-1-tritylpiperidin-4-ol;S-[(3E)-3-(furan-3-ylmethylidene)piperidin-4-yl] ethanethioate;hydrochloride.
| Compound Name | (3E)-3-benzylidene-1-tritylpiperidin-4-ol;S-[(3E)-3-(furan-3-ylmethylidene)piperidin-4-yl] ethanethioate;hydrochloride |
|---|---|
| PubChem CID | 159813400 |
| Molecular Formula | C43H45ClN2O3S |
| Molecular Weight | 705.36 g/mol |
| Exact Mass | 704.28 |
| IUPAC Name | (3E)-3-benzylidene-1-tritylpiperidin-4-ol;S-[(3E)-3-(furan-3-ylmethylidene)piperidin-4-yl] ethanethioate;hydrochloride |
| SMILES | CC(=O)SC1CCNC/C1=C\c1ccoc1.Cl.OC1CCN(C(c2ccccc2)(c2ccccc2)c2ccccc2)C/C1=C\c1ccccc1 |
| InChI | InChI=1S/C31H29NO.C12H15NO2S.ClH/c33-30-21-22-32(24-26(30)23-25-13-5-1-6-14-25)31(27-15-7-2-8-16-27,28-17-9-3-10-18-28)29-19-11-4-12-20-29;1-9(14)16-12-2-4-13-7-11(12)6-10-3-5-15-8-10;/h1-20,23,30,33H,21-22,24H2;3,5-6,8,12-13H,2,4,7H2,1H3;1H/b26-23+;11-6+; |
| InChIKey | ZPMLJIFTAFVICE-UZCGEAEDSA-N |
| XLogP | 8.86 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.36 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|