C32H32N4O3S — CID 86609443
methyl 2-[4-[(E)-(4-acetylsulfanyl-1-tritylpiperidin-3-ylidene)methyl]triazol-1-yl]acetate (PubChem CID 86609443) has the molecular formula C32H32N4O3S and a molecular weight of 552.70 g/mol. Its IUPAC name is methyl 2-[4-[(E)-(4-acetylsulfanyl-1-tritylpiperidin-3-ylidene)methyl]triazol-1-yl]acetate.
| Compound Name | methyl 2-[4-[(E)-(4-acetylsulfanyl-1-tritylpiperidin-3-ylidene)methyl]triazol-1-yl]acetate |
|---|---|
| PubChem CID | 86609443 |
| Molecular Formula | C32H32N4O3S |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | methyl 2-[4-[(E)-(4-acetylsulfanyl-1-tritylpiperidin-3-ylidene)methyl]triazol-1-yl]acetate |
| SMILES | COC(=O)Cn1cc(/C=C2\CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CCC2SC(C)=O)nn1 |
| InChI | InChI=1S/C32H32N4O3S/c1-24(37)40-30-18-19-35(21-25(30)20-29-22-36(34-33-29)23-31(38)39-2)32(26-12-6-3-7-13-26,27-14-8-4-9-15-27)28-16-10-5-11-17-28/h3-17,20,22,30H,18-19,21,23H2,1-2H3/b25-20+ |
| InChIKey | LQFTYWLRYRMONJ-LKUDQCMESA-N |
| XLogP | 5.18 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|