C32H30N2OS — CID 90831372
S-[3-(pyridin-3-ylmethylidene)-1-tritylpiperidin-4-yl] ethanethioate (PubChem CID 90831372) has the molecular formula C32H30N2OS and a molecular weight of 490.67 g/mol. Its IUPAC name is S-[3-(pyridin-3-ylmethylidene)-1-tritylpiperidin-4-yl] ethanethioate.
| Compound Name | S-[3-(pyridin-3-ylmethylidene)-1-tritylpiperidin-4-yl] ethanethioate |
|---|---|
| PubChem CID | 90831372 |
| Molecular Formula | C32H30N2OS |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | S-[3-(pyridin-3-ylmethylidene)-1-tritylpiperidin-4-yl] ethanethioate |
| SMILES | CC(=O)SC1CCN(C(c2ccccc2)(c2ccccc2)c2ccccc2)CC1=Cc1cccnc1 |
| InChI | InChI=1S/C32H30N2OS/c1-25(35)36-31-19-21-34(24-27(31)22-26-12-11-20-33-23-26)32(28-13-5-2-6-14-28,29-15-7-3-8-16-29)30-17-9-4-10-18-30/h2-18,20,22-23,31H,19,21,24H2,1H3 |
| InChIKey | VAIKDQTVAILOJP-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|