C32H44N2O3 — CID 160793236
diphenyl-(1-prop-2-enylpiperidin-4-yl)methanol;ethyl 1-prop-2-enylpiperidine-4-carboxylate (PubChem CID 160793236) has the molecular formula C32H44N2O3 and a molecular weight of 504.72 g/mol. Its IUPAC name is diphenyl-(1-prop-2-enylpiperidin-4-yl)methanol;ethyl 1-prop-2-enylpiperidine-4-carboxylate.
| Compound Name | diphenyl-(1-prop-2-enylpiperidin-4-yl)methanol;ethyl 1-prop-2-enylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 160793236 |
| Molecular Formula | C32H44N2O3 |
| Molecular Weight | 504.72 g/mol |
| Exact Mass | 504.34 |
| IUPAC Name | diphenyl-(1-prop-2-enylpiperidin-4-yl)methanol;ethyl 1-prop-2-enylpiperidine-4-carboxylate |
| SMILES | C=CCN1CCC(C(=O)OCC)CC1.C=CCN1CCC(C(O)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H25NO.C11H19NO2/c1-2-15-22-16-13-20(14-17-22)21(23,18-9-5-3-6-10-18)19-11-7-4-8-12-19;1-3-7-12-8-5-10(6-9-12)11(13)14-4-2/h2-12,20,23H,1,13-17H2;3,10H,1,4-9H2,2H3 |
| InChIKey | SCCFRZZJVAREKY-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.72 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|