C19H23NO4 — CID 12706471
ethyl 1-oxo-1'-prop-2-enylspiro[4H-isochromene-3,4'-piperidine]-4-carboxylate (PubChem CID 12706471) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is ethyl 1-oxo-1'-prop-2-enylspiro[4H-isochromene-3,4'-piperidine]-4-carboxylate.
| Compound Name | ethyl 1-oxo-1'-prop-2-enylspiro[4H-isochromene-3,4'-piperidine]-4-carboxylate |
|---|---|
| PubChem CID | 12706471 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | ethyl 1-oxo-1'-prop-2-enylspiro[4H-isochromene-3,4'-piperidine]-4-carboxylate |
| SMILES | C=CCN1CCC2(CC1)OC(=O)c1ccccc1C2C(=O)OCC |
| InChI | InChI=1S/C19H23NO4/c1-3-11-20-12-9-19(10-13-20)16(18(22)23-4-2)14-7-5-6-8-15(14)17(21)24-19/h3,5-8,16H,1,4,9-13H2,2H3 |
| InChIKey | QVPFEQHXHWXBIX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|