About ethyl 1-oxo-1'-prop-2-enylspiro[4H-isochromene-3,4'-piperidine]-4-carboxylate
ethyl 1-oxo-1'-prop-2-enylspiro[4H-isochromene-3,4'-piperidine]-4-carboxylate (PubChem CID 12706471) has the molecular formula C19H23NO4
and a molecular weight of 329.40 g/mol. Its IUPAC name is ethyl 1-oxo-1'-prop-2-enylspiro[4H-isochromene-3,4'-piperidine]-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-oxo-1'-prop-2-enylspiro[4H-isochromene-3,4'-piperidine]-4-carboxylate |
| PubChem CID | 12706471 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | ethyl 1-oxo-1'-prop-2-enylspiro[4H-isochromene-3,4'-piperidine]-4-carboxylate |
| SMILES | C=CCN1CCC2(CC1)OC(=O)c1ccccc1C2C(=O)OCC |
| InChI | InChI=1S/C19H23NO4/c1-3-11-20-12-9-19(10-13-20)16(18(22)23-4-2)14-7-5-6-8-15(14)17(21)24-19/h3,5-8,16H,1,4,9-13H2,2H3 |
| InChIKey | QVPFEQHXHWXBIX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-oxo-1'-prop-2-enylspiro[4H-isochromene-3,4'-piperidine]-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-oxo-1'-prop-2-enylspiro[4H-isochromene-3,4'-piperidine]-4-carboxylate?
The IUPAC name of ethyl 1-oxo-1'-prop-2-enylspiro[4H-isochromene-3,4'-piperidine]-4-carboxylate (CID 12706471) is ethyl 1-oxo-1'-prop-2-enylspiro[4H-isochromene-3,4'-piperidine]-4-carboxylate.
What is the SMILES notation for ethyl 1-oxo-1'-prop-2-enylspiro[4H-isochromene-3,4'-piperidine]-4-carboxylate?
The canonical SMILES for ethyl 1-oxo-1'-prop-2-enylspiro[4H-isochromene-3,4'-piperidine]-4-carboxylate is C=CCN1CCC2(CC1)OC(=O)c1ccccc1C2C(=O)OCC.
What is the InChIKey of ethyl 1-oxo-1'-prop-2-enylspiro[4H-isochromene-3,4'-piperidine]-4-carboxylate?
The InChIKey is QVPFEQHXHWXBIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO4/c1-3-11-20-12-9-19(10-13-20)16(18(22)23-4-2)14-7-5-6-8-15(14)17(21)24-19/h3,5-8,16H,1,4,9-13H2,2H3.
What are the key properties of ethyl 1-oxo-1'-prop-2-enylspiro[4H-isochromene-3,4'-piperidine]-4-carboxylate?
ethyl 1-oxo-1'-prop-2-enylspiro[4H-isochromene-3,4'-piperidine]-4-carboxylate has a molecular weight of 329.40 g/mol, XLogP of 2.52, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-oxo-1'-prop-2-enylspiro[4H-isochromene-3,4'-piperidine]-4-carboxylate is sourced from PubChem (CID 12706471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).