C22H27Cl2NO2S — CID 91476293
(4-methylphenyl)-phenyl-(1-prop-2-enylpiperidin-4-yl)methanol;thionyl dichloride (PubChem CID 91476293) has the molecular formula C22H27Cl2NO2S and a molecular weight of 440.44 g/mol. Its IUPAC name is (4-methylphenyl)-phenyl-(1-prop-2-enylpiperidin-4-yl)methanol;thionyl dichloride.
| Compound Name | (4-methylphenyl)-phenyl-(1-prop-2-enylpiperidin-4-yl)methanol;thionyl dichloride |
|---|---|
| PubChem CID | 91476293 |
| Molecular Formula | C22H27Cl2NO2S |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | (4-methylphenyl)-phenyl-(1-prop-2-enylpiperidin-4-yl)methanol;thionyl dichloride |
| SMILES | C=CCN1CCC(C(O)(c2ccccc2)c2ccc(C)cc2)CC1.O=S(Cl)Cl |
| InChI | InChI=1S/C22H27NO.Cl2OS/c1-3-15-23-16-13-21(14-17-23)22(24,19-7-5-4-6-8-19)20-11-9-18(2)10-12-20;1-4(2)3/h3-12,21,24H,1,13-17H2,2H3; |
| InChIKey | FPIKUGZMZMNKQQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|