About (3Z)-3-[(2,5-dimethylpyrazol-3-yl)methylidene]-1-tritylpiperidin-4-one
(3Z)-3-[(2,5-dimethylpyrazol-3-yl)methylidene]-1-tritylpiperidin-4-one (PubChem CID 68766099) has the molecular formula C30H29N3O
and a molecular weight of 447.58 g/mol. Its IUPAC name is (3Z)-3-[(2,5-dimethylpyrazol-3-yl)methylidene]-1-tritylpiperidin-4-one.
Molecular Properties
| Compound Name | (3Z)-3-[(2,5-dimethylpyrazol-3-yl)methylidene]-1-tritylpiperidin-4-one |
| PubChem CID | 68766099 |
| Molecular Formula | C30H29N3O |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | (3Z)-3-[(2,5-dimethylpyrazol-3-yl)methylidene]-1-tritylpiperidin-4-one |
| SMILES | Cc1cc(/C=C2/CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CCC2=O)n(C)n1 |
| InChI | InChI=1S/C30H29N3O/c1-23-20-28(32(2)31-23)21-24-22-33(19-18-29(24)34)30(25-12-6-3-7-13-25,26-14-8-4-9-15-26)27-16-10-5-11-17-27/h3-17,20-21H,18-19,22H2,1-2H3/b24-21- |
| InChIKey | IZZJKJJZMWXLKX-FLFQWRMESA-N |
| XLogP | 5.38 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-[(2,5-dimethylpyrazol-3-yl)methylidene]-1-tritylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-[(2,5-dimethylpyrazol-3-yl)methylidene]-1-tritylpiperidin-4-one?
The IUPAC name of (3Z)-3-[(2,5-dimethylpyrazol-3-yl)methylidene]-1-tritylpiperidin-4-one (CID 68766099) is (3Z)-3-[(2,5-dimethylpyrazol-3-yl)methylidene]-1-tritylpiperidin-4-one.
What is the SMILES notation for (3Z)-3-[(2,5-dimethylpyrazol-3-yl)methylidene]-1-tritylpiperidin-4-one?
The canonical SMILES for (3Z)-3-[(2,5-dimethylpyrazol-3-yl)methylidene]-1-tritylpiperidin-4-one is Cc1cc(/C=C2/CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CCC2=O)n(C)n1.
What is the InChIKey of (3Z)-3-[(2,5-dimethylpyrazol-3-yl)methylidene]-1-tritylpiperidin-4-one?
The InChIKey is IZZJKJJZMWXLKX-FLFQWRMESA-N. The full InChI is InChI=1S/C30H29N3O/c1-23-20-28(32(2)31-23)21-24-22-33(19-18-29(24)34)30(25-12-6-3-7-13-25,26-14-8-4-9-15-26)27-16-10-5-11-17-27/h3-17,20-21H,18-19,22H2,1-2H3/b24-21-.
What are the key properties of (3Z)-3-[(2,5-dimethylpyrazol-3-yl)methylidene]-1-tritylpiperidin-4-one?
(3Z)-3-[(2,5-dimethylpyrazol-3-yl)methylidene]-1-tritylpiperidin-4-one has a molecular weight of 447.58 g/mol, XLogP of 5.38, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-[(2,5-dimethylpyrazol-3-yl)methylidene]-1-tritylpiperidin-4-one is sourced from PubChem (CID 68766099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).