C34H36N4O3 — CID 23139262
ethyl 5-[5-[(E)-(4-oxo-1-tritylpiperidin-3-ylidene)methyl]triazol-1-yl]pentanoate (PubChem CID 23139262) has the molecular formula C34H36N4O3 and a molecular weight of 548.69 g/mol. Its IUPAC name is ethyl 5-[5-[(E)-(4-oxo-1-tritylpiperidin-3-ylidene)methyl]triazol-1-yl]pentanoate.
| Compound Name | ethyl 5-[5-[(E)-(4-oxo-1-tritylpiperidin-3-ylidene)methyl]triazol-1-yl]pentanoate |
|---|---|
| PubChem CID | 23139262 |
| Molecular Formula | C34H36N4O3 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | ethyl 5-[5-[(E)-(4-oxo-1-tritylpiperidin-3-ylidene)methyl]triazol-1-yl]pentanoate |
| SMILES | CCOC(=O)CCCCn1nncc1/C=C1\CN(C(c2ccccc2)(c2ccccc2)c2ccccc2)CCC1=O |
| InChI | InChI=1S/C34H36N4O3/c1-2-41-33(40)20-12-13-22-38-31(25-35-36-38)24-27-26-37(23-21-32(27)39)34(28-14-6-3-7-15-28,29-16-8-4-9-17-29)30-18-10-5-11-19-30/h3-11,14-19,24-25H,2,12-13,20-23,26H2,1H3/b27-24+ |
| InChIKey | IQUSLTRSRWMITR-SOYKGTTHSA-N |
| XLogP | 5.66 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|