C9H15N3O2 — CID 53407742
tert-butyl 3-(aminomethyl)pyrazole-1-carboxylate (PubChem CID 53407742) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is tert-butyl 3-(aminomethyl)pyrazole-1-carboxylate.
| Compound Name | tert-butyl 3-(aminomethyl)pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 53407742 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | tert-butyl 3-(aminomethyl)pyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ccc(CN)n1 |
| InChI | InChI=1S/C9H15N3O2/c1-9(2,3)14-8(13)12-5-4-7(6-10)11-12/h4-5H,6,10H2,1-3H3 |
| InChIKey | JWJUTEOCSPBLBV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |