C19H32N2O3 — CID 142372510
tert-butyl 3-(3,3-dicyclopropylpropoxy)pyrazole-1-carboxylate;ethane (PubChem CID 142372510) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is tert-butyl 3-(3,3-dicyclopropylpropoxy)pyrazole-1-carboxylate;ethane.
| Compound Name | tert-butyl 3-(3,3-dicyclopropylpropoxy)pyrazole-1-carboxylate;ethane |
|---|---|
| PubChem CID | 142372510 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | tert-butyl 3-(3,3-dicyclopropylpropoxy)pyrazole-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)n1ccc(OCCC(C2CC2)C2CC2)n1 |
| InChI | InChI=1S/C17H26N2O3.C2H6/c1-17(2,3)22-16(20)19-10-8-15(18-19)21-11-9-14(12-4-5-12)13-6-7-13;1-2/h8,10,12-14H,4-7,9,11H2,1-3H3;1-2H3 |
| InChIKey | HXPANDROGAKGGY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |