C17H23BN2O3 — CID 153335568
CID 153335568 (PubChem CID 153335568) has the molecular formula C17H23BN2O3 and a molecular weight of 314.19 g/mol.
| Compound Name | CID 153335568 |
|---|---|
| PubChem CID | 153335568 |
| Molecular Formula | C17H23BN2O3 |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | — |
| SMILES | [B]C1(CCOc2ccn(C(=O)OC(C)(C)C)n2)C2(CC2)C12CC2 |
| InChI | InChI=1S/C17H23BN2O3/c1-14(2,3)23-13(21)20-10-4-12(19-20)22-11-9-17(18)15(5-6-15)16(17)7-8-16/h4,10H,5-9,11H2,1-3H3 |
| InChIKey | NYYPUIWLQGOIBD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|