C16H16FN3O3 — CID 162737357
tert-butyl 3-[(4-cyano-2-fluorophenyl)methoxy]pyrazole-1-carboxylate (PubChem CID 162737357) has the molecular formula C16H16FN3O3 and a molecular weight of 317.32 g/mol. Its IUPAC name is tert-butyl 3-[(4-cyano-2-fluorophenyl)methoxy]pyrazole-1-carboxylate.
| Compound Name | tert-butyl 3-[(4-cyano-2-fluorophenyl)methoxy]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 162737357 |
| Molecular Formula | C16H16FN3O3 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | tert-butyl 3-[(4-cyano-2-fluorophenyl)methoxy]pyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ccc(OCc2ccc(C#N)cc2F)n1 |
| InChI | InChI=1S/C16H16FN3O3/c1-16(2,3)23-15(21)20-7-6-14(19-20)22-10-12-5-4-11(9-18)8-13(12)17/h4-8H,10H2,1-3H3 |
| InChIKey | AGULJEGRYSAOOS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |