C16H19FN4O — CID 164914842
4-[[1-(1-aminopentan-3-yl)pyrazol-3-yl]oxymethyl]-3-fluorobenzonitrile (PubChem CID 164914842) has the molecular formula C16H19FN4O and a molecular weight of 302.35 g/mol. Its IUPAC name is 4-[[1-(1-aminopentan-3-yl)pyrazol-3-yl]oxymethyl]-3-fluorobenzonitrile.
| Compound Name | 4-[[1-(1-aminopentan-3-yl)pyrazol-3-yl]oxymethyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 164914842 |
| Molecular Formula | C16H19FN4O |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 4-[[1-(1-aminopentan-3-yl)pyrazol-3-yl]oxymethyl]-3-fluorobenzonitrile |
| SMILES | CCC(CCN)n1ccc(OCc2ccc(C#N)cc2F)n1 |
| InChI | InChI=1S/C16H19FN4O/c1-2-14(5-7-18)21-8-6-16(20-21)22-11-13-4-3-12(10-19)9-15(13)17/h3-4,6,8-9,14H,2,5,7,11,18H2,1H3 |
| InChIKey | KONZKAAMSFIFCD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |