C16H24N2O3 — CID 153410858
butyl 3-(2,2-dicyclopropylethoxy)pyrazole-1-carboxylate (PubChem CID 153410858) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is butyl 3-(2,2-dicyclopropylethoxy)pyrazole-1-carboxylate.
| Compound Name | butyl 3-(2,2-dicyclopropylethoxy)pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 153410858 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | butyl 3-(2,2-dicyclopropylethoxy)pyrazole-1-carboxylate |
| SMILES | CCCCOC(=O)n1ccc(OCC(C2CC2)C2CC2)n1 |
| InChI | InChI=1S/C16H24N2O3/c1-2-3-10-20-16(19)18-9-8-15(17-18)21-11-14(12-4-5-12)13-6-7-13/h8-9,12-14H,2-7,10-11H2,1H3 |
| InChIKey | HIYUFNVDIZBADB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|