About hexyl pyrazole-1-carboxylate
hexyl pyrazole-1-carboxylate (PubChem CID 134846736) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is hexyl pyrazole-1-carboxylate.
Molecular Properties
| Compound Name | hexyl pyrazole-1-carboxylate |
| PubChem CID | 134846736 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | hexyl pyrazole-1-carboxylate |
| SMILES | CCCCCCOC(=O)n1cccn1 |
| InChI | InChI=1S/C10H16N2O2/c1-2-3-4-5-9-14-10(13)12-8-6-7-11-12/h6-8H,2-5,9H2,1H3 |
| InChIKey | BIBTXCXNQQKMER-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexyl pyrazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl pyrazole-1-carboxylate?
The IUPAC name of hexyl pyrazole-1-carboxylate (CID 134846736) is hexyl pyrazole-1-carboxylate.
What is the SMILES notation for hexyl pyrazole-1-carboxylate?
The canonical SMILES for hexyl pyrazole-1-carboxylate is CCCCCCOC(=O)n1cccn1.
What is the InChIKey of hexyl pyrazole-1-carboxylate?
The InChIKey is BIBTXCXNQQKMER-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-2-3-4-5-9-14-10(13)12-8-6-7-11-12/h6-8H,2-5,9H2,1H3.
What are the key properties of hexyl pyrazole-1-carboxylate?
hexyl pyrazole-1-carboxylate has a molecular weight of 196.25 g/mol, XLogP of 2.45, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl pyrazole-1-carboxylate is sourced from PubChem (CID 134846736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).