About octyl 3-bromo-2-oxopropanoate
octyl 3-bromo-2-oxopropanoate (PubChem CID 134208644) has the molecular formula C11H19BrO3
and a molecular weight of 279.17 g/mol. Its IUPAC name is octyl 3-bromo-2-oxopropanoate.
Molecular Properties
| Compound Name | octyl 3-bromo-2-oxopropanoate |
| PubChem CID | 134208644 |
| Molecular Formula | C11H19BrO3 |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | octyl 3-bromo-2-oxopropanoate |
| SMILES | CCCCCCCCOC(=O)C(=O)CBr |
| InChI | InChI=1S/C11H19BrO3/c1-2-3-4-5-6-7-8-15-11(14)10(13)9-12/h2-9H2,1H3 |
| InChIKey | ZWAHJKVTQLQIJC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze octyl 3-bromo-2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octyl 3-bromo-2-oxopropanoate?
The IUPAC name of octyl 3-bromo-2-oxopropanoate (CID 134208644) is octyl 3-bromo-2-oxopropanoate.
What is the SMILES notation for octyl 3-bromo-2-oxopropanoate?
The canonical SMILES for octyl 3-bromo-2-oxopropanoate is CCCCCCCCOC(=O)C(=O)CBr.
What is the InChIKey of octyl 3-bromo-2-oxopropanoate?
The InChIKey is ZWAHJKVTQLQIJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19BrO3/c1-2-3-4-5-6-7-8-15-11(14)10(13)9-12/h2-9H2,1H3.
What are the key properties of octyl 3-bromo-2-oxopropanoate?
octyl 3-bromo-2-oxopropanoate has a molecular weight of 279.17 g/mol, XLogP of 2.85, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octyl 3-bromo-2-oxopropanoate is sourced from PubChem (CID 134208644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).