About hexyl 3-bromo-2-oxopropanoate
hexyl 3-bromo-2-oxopropanoate (PubChem CID 23332064) has the molecular formula C9H15BrO3
and a molecular weight of 251.12 g/mol. Its IUPAC name is hexyl 3-bromo-2-oxopropanoate.
Molecular Properties
| Compound Name | hexyl 3-bromo-2-oxopropanoate |
| PubChem CID | 23332064 |
| Molecular Formula | C9H15BrO3 |
| Molecular Weight | 251.12 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | hexyl 3-bromo-2-oxopropanoate |
| SMILES | CCCCCCOC(=O)C(=O)CBr |
| InChI | InChI=1S/C9H15BrO3/c1-2-3-4-5-6-13-9(12)8(11)7-10/h2-7H2,1H3 |
| InChIKey | JAZGLJMIYVVLFG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.12 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze hexyl 3-bromo-2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl 3-bromo-2-oxopropanoate?
The IUPAC name of hexyl 3-bromo-2-oxopropanoate (CID 23332064) is hexyl 3-bromo-2-oxopropanoate.
What is the SMILES notation for hexyl 3-bromo-2-oxopropanoate?
The canonical SMILES for hexyl 3-bromo-2-oxopropanoate is CCCCCCOC(=O)C(=O)CBr.
What is the InChIKey of hexyl 3-bromo-2-oxopropanoate?
The InChIKey is JAZGLJMIYVVLFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15BrO3/c1-2-3-4-5-6-13-9(12)8(11)7-10/h2-7H2,1H3.
What are the key properties of hexyl 3-bromo-2-oxopropanoate?
hexyl 3-bromo-2-oxopropanoate has a molecular weight of 251.12 g/mol, XLogP of 2.07, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl 3-bromo-2-oxopropanoate is sourced from PubChem (CID 23332064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).