About tetradecyl 3-bromo-2-oxopropanoate
tetradecyl 3-bromo-2-oxopropanoate (PubChem CID 134208650) has the molecular formula C17H31BrO3
and a molecular weight of 363.34 g/mol. Its IUPAC name is tetradecyl 3-bromo-2-oxopropanoate.
Molecular Properties
| Compound Name | tetradecyl 3-bromo-2-oxopropanoate |
| PubChem CID | 134208650 |
| Molecular Formula | C17H31BrO3 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | tetradecyl 3-bromo-2-oxopropanoate |
| SMILES | CCCCCCCCCCCCCCOC(=O)C(=O)CBr |
| InChI | InChI=1S/C17H31BrO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-21-17(20)16(19)15-18/h2-15H2,1H3 |
| InChIKey | GZSLNMVZKCOERI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze tetradecyl 3-bromo-2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetradecyl 3-bromo-2-oxopropanoate?
The IUPAC name of tetradecyl 3-bromo-2-oxopropanoate (CID 134208650) is tetradecyl 3-bromo-2-oxopropanoate.
What is the SMILES notation for tetradecyl 3-bromo-2-oxopropanoate?
The canonical SMILES for tetradecyl 3-bromo-2-oxopropanoate is CCCCCCCCCCCCCCOC(=O)C(=O)CBr.
What is the InChIKey of tetradecyl 3-bromo-2-oxopropanoate?
The InChIKey is GZSLNMVZKCOERI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31BrO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-21-17(20)16(19)15-18/h2-15H2,1H3.
What are the key properties of tetradecyl 3-bromo-2-oxopropanoate?
tetradecyl 3-bromo-2-oxopropanoate has a molecular weight of 363.34 g/mol, XLogP of 5.19, 15 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tetradecyl 3-bromo-2-oxopropanoate is sourced from PubChem (CID 134208650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).