C34H33N5O2 — CID 23139287
(3Z)-3-[[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]methylidene]-1-tritylpiperidin-4-ol (PubChem CID 23139287) has the molecular formula C34H33N5O2 and a molecular weight of 543.67 g/mol. Its IUPAC name is (3Z)-3-[[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]methylidene]-1-tritylpiperidin-4-ol.
| Compound Name | (3Z)-3-[[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]methylidene]-1-tritylpiperidin-4-ol |
|---|---|
| PubChem CID | 23139287 |
| Molecular Formula | C34H33N5O2 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | (3Z)-3-[[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]methylidene]-1-tritylpiperidin-4-ol |
| SMILES | COc1ccc(Cn2nnnc2/C=C2/CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CCC2O)cc1 |
| InChI | InChI=1S/C34H33N5O2/c1-41-31-19-17-26(18-20-31)24-39-33(35-36-37-39)23-27-25-38(22-21-32(27)40)34(28-11-5-2-6-12-28,29-13-7-3-8-14-29)30-15-9-4-10-16-30/h2-20,23,32,40H,21-22,24-25H2,1H3/b27-23- |
| InChIKey | FYMZVDROVFRIFD-VYIQYICTSA-N |
| XLogP | 5.17 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|