C21H38O3Si — CID 10926661
(2S)-2-[(2R,3R)-3-tri(propan-2-yl)silyloxyhept-6-en-2-yl]-2,3-dihydropyran-6-one (PubChem CID 10926661) has the molecular formula C21H38O3Si and a molecular weight of 366.62 g/mol. Its IUPAC name is (2S)-2-[(2R,3R)-3-tri(propan-2-yl)silyloxyhept-6-en-2-yl]-2,3-dihydropyran-6-one.
| Compound Name | (2S)-2-[(2R,3R)-3-tri(propan-2-yl)silyloxyhept-6-en-2-yl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 10926661 |
| Molecular Formula | C21H38O3Si |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | (2S)-2-[(2R,3R)-3-tri(propan-2-yl)silyloxyhept-6-en-2-yl]-2,3-dihydropyran-6-one |
| SMILES | C=CCC[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)[C@@H]1CC=CC(=O)O1 |
| InChI | InChI=1S/C21H38O3Si/c1-9-10-12-20(18(8)19-13-11-14-21(22)23-19)24-25(15(2)3,16(4)5)17(6)7/h9,11,14-20H,1,10,12-13H2,2-8H3/t18-,19+,20-/m1/s1 |
| InChIKey | BHRVSIRKTFXXOF-HSALFYBXSA-N |
| XLogP | 6.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|