C17H34O3Si — CID 11197810
ethyl (E,4S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylhept-2-enoate (PubChem CID 11197810) has the molecular formula C17H34O3Si and a molecular weight of 314.54 g/mol. Its IUPAC name is ethyl (E,4S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylhept-2-enoate.
| Compound Name | ethyl (E,4S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylhept-2-enoate |
|---|---|
| PubChem CID | 11197810 |
| Molecular Formula | C17H34O3Si |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | ethyl (E,4S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylhept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](C)C[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O3Si/c1-9-19-16(18)11-10-14(2)12-15(3)13-20-21(7,8)17(4,5)6/h10-11,14-15H,9,12-13H2,1-8H3/b11-10+/t14-,15-/m1/s1 |
| InChIKey | RIKBXZYQZCXREU-UWLACMPISA-N |
| XLogP | 4.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|