C23H46O4Si2 — CID 25022837
methyl (2Z,4E,6R,7S)-7,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methylnona-2,4-dienoate (PubChem CID 25022837) has the molecular formula C23H46O4Si2 and a molecular weight of 442.79 g/mol. Its IUPAC name is methyl (2Z,4E,6R,7S)-7,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methylnona-2,4-dienoate.
| Compound Name | methyl (2Z,4E,6R,7S)-7,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methylnona-2,4-dienoate |
|---|---|
| PubChem CID | 25022837 |
| Molecular Formula | C23H46O4Si2 |
| Molecular Weight | 442.79 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | methyl (2Z,4E,6R,7S)-7,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methylnona-2,4-dienoate |
| SMILES | COC(=O)/C=C\C=C\[C@@H](C)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46O4Si2/c1-19(15-13-14-16-21(24)25-8)20(27-29(11,12)23(5,6)7)17-18-26-28(9,10)22(2,3)4/h13-16,19-20H,17-18H2,1-12H3/b15-13+,16-14-/t19-,20+/m1/s1 |
| InChIKey | RBRCPIWJBOFKJB-BQLRTYBMSA-N |
| XLogP | 6.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.79 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|