C19H34O2Si — CID 134999408
(4S,7R)-4-cyclohexyl-2,2-di(propan-2-yl)-7-[(E)-prop-1-enyl]-4,7-dihydro-1,3,2-dioxasilepine (PubChem CID 134999408) has the molecular formula C19H34O2Si and a molecular weight of 322.57 g/mol. Its IUPAC name is (4S,7R)-4-cyclohexyl-2,2-di(propan-2-yl)-7-[(E)-prop-1-enyl]-4,7-dihydro-1,3,2-dioxasilepine.
| Compound Name | (4S,7R)-4-cyclohexyl-2,2-di(propan-2-yl)-7-[(E)-prop-1-enyl]-4,7-dihydro-1,3,2-dioxasilepine |
|---|---|
| PubChem CID | 134999408 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.57 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (4S,7R)-4-cyclohexyl-2,2-di(propan-2-yl)-7-[(E)-prop-1-enyl]-4,7-dihydro-1,3,2-dioxasilepine |
| SMILES | C/C=C/[C@@H]1C=C[C@H](C2CCCCC2)O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C19H34O2Si/c1-6-10-18-13-14-19(17-11-8-7-9-12-17)21-22(20-18,15(2)3)16(4)5/h6,10,13-19H,7-9,11-12H2,1-5H3/b10-6+/t18-,19-/m1/s1 |
| InChIKey | IWLXBXDJVKBFDP-CTDFLUCESA-N |
| XLogP | 5.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.57 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|