C23H46O2Si2 — CID 11774244
trimethyl-[(3R,5R)-5-methyl-3-[(E)-4-tri(propan-2-yl)silyloxybut-2-en-2-yl]cyclohexen-1-yl]oxysilane (PubChem CID 11774244) has the molecular formula C23H46O2Si2 and a molecular weight of 410.79 g/mol. Its IUPAC name is trimethyl-[(3R,5R)-5-methyl-3-[(E)-4-tri(propan-2-yl)silyloxybut-2-en-2-yl]cyclohexen-1-yl]oxysilane.
| Compound Name | trimethyl-[(3R,5R)-5-methyl-3-[(E)-4-tri(propan-2-yl)silyloxybut-2-en-2-yl]cyclohexen-1-yl]oxysilane |
|---|---|
| PubChem CID | 11774244 |
| Molecular Formula | C23H46O2Si2 |
| Molecular Weight | 410.79 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | trimethyl-[(3R,5R)-5-methyl-3-[(E)-4-tri(propan-2-yl)silyloxybut-2-en-2-yl]cyclohexen-1-yl]oxysilane |
| SMILES | C/C(=C\CO[Si](C(C)C)(C(C)C)C(C)C)[C@H]1C=C(O[Si](C)(C)C)C[C@H](C)C1 |
| InChI | InChI=1S/C23H46O2Si2/c1-17(2)27(18(3)4,19(5)6)24-13-12-21(8)22-14-20(7)15-23(16-22)25-26(9,10)11/h12,16-20,22H,13-15H2,1-11H3/b21-12+/t20-,22-/m1/s1 |
| InChIKey | KSRCNQPIFNWMNA-QHHXDTQKSA-N |
| XLogP | 7.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.79 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|