C20H34OSi — CID 11244074
[(3S,5R)-3-buta-2,3-dien-2-yl-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11244074) has the molecular formula C20H34OSi and a molecular weight of 318.58 g/mol. Its IUPAC name is [(3S,5R)-3-buta-2,3-dien-2-yl-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3S,5R)-3-buta-2,3-dien-2-yl-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11244074 |
| Molecular Formula | C20H34OSi |
| Molecular Weight | 318.58 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | [(3S,5R)-3-buta-2,3-dien-2-yl-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C=C(C)[C@@H]1C[C@@H](C(=C)C)CC(O[Si](C)(C)C(C)(C)C)=C1C |
| InChI | InChI=1S/C20H34OSi/c1-11-15(4)18-12-17(14(2)3)13-19(16(18)5)21-22(9,10)20(6,7)8/h17-18H,1-2,12-13H2,3-10H3/t17-,18+/m1/s1 |
| InChIKey | LRPQEBHVYUQBEX-MSOLQXFVSA-N |
| XLogP | 6.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.58 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|