C16H31LiO2Si — CID 134846364
lithium (Z,1S)-1-[tert-butyl(dimethyl)silyl]oxy-1-cyclohexylbut-2-en-2-olate (PubChem CID 134846364) has the molecular formula C16H31LiO2Si and a molecular weight of 290.45 g/mol. Its IUPAC name is lithium (Z,1S)-1-[tert-butyl(dimethyl)silyl]oxy-1-cyclohexylbut-2-en-2-olate.
| Compound Name | lithium (Z,1S)-1-[tert-butyl(dimethyl)silyl]oxy-1-cyclohexylbut-2-en-2-olate |
|---|---|
| PubChem CID | 134846364 |
| Molecular Formula | C16H31LiO2Si |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.23 |
| IUPAC Name | lithium (Z,1S)-1-[tert-butyl(dimethyl)silyl]oxy-1-cyclohexylbut-2-en-2-olate |
| SMILES | C/C=C(\[O-])[C@@H](O[Si](C)(C)C(C)(C)C)C1CCCCC1.[Li+] |
| InChI | InChI=1S/C16H32O2Si.Li/c1-7-14(17)15(13-11-9-8-10-12-13)18-19(5,6)16(2,3)4;/h7,13,15,17H,8-12H2,1-6H3;/q;+1/p-1/b14-7-;/t15-;/m0./s1 |
| InChIKey | OUVMZWKNHZLFGI-FBGSUMGISA-M |
| XLogP | 1.23 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|