C17H33LiO2Si — CID 135050233
lithium (Z,4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-cyclohexylpent-2-en-3-olate (PubChem CID 135050233) has the molecular formula C17H33LiO2Si and a molecular weight of 304.48 g/mol. Its IUPAC name is lithium (Z,4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-cyclohexylpent-2-en-3-olate.
| Compound Name | lithium (Z,4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-cyclohexylpent-2-en-3-olate |
|---|---|
| PubChem CID | 135050233 |
| Molecular Formula | C17H33LiO2Si |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | lithium (Z,4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-cyclohexylpent-2-en-3-olate |
| SMILES | C/C=C(\[O-])[C@@](C)(O[Si](C)(C)C(C)(C)C)C1CCCCC1.[Li+] |
| InChI | InChI=1S/C17H34O2Si.Li/c1-8-15(18)17(5,14-12-10-9-11-13-14)19-20(6,7)16(2,3)4;/h8,14,18H,9-13H2,1-7H3;/q;+1/p-1/b15-8-;/t17-;/m0./s1 |
| InChIKey | LWLGTJNIAXJYBE-SMHMBWIZSA-M |
| XLogP | 1.62 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|