C17H34O2Si — CID 135050234
(Z,4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-cyclohexylpent-2-en-3-ol (PubChem CID 135050234) has the molecular formula C17H34O2Si and a molecular weight of 298.54 g/mol. Its IUPAC name is (Z,4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-cyclohexylpent-2-en-3-ol.
| Compound Name | (Z,4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-cyclohexylpent-2-en-3-ol |
|---|---|
| PubChem CID | 135050234 |
| Molecular Formula | C17H34O2Si |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (Z,4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-cyclohexylpent-2-en-3-ol |
| SMILES | C/C=C(\O)[C@@](C)(O[Si](C)(C)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C17H34O2Si/c1-8-15(18)17(5,14-12-10-9-11-13-14)19-20(6,7)16(2,3)4/h8,14,18H,9-13H2,1-7H3/b15-8-/t17-/m0/s1 |
| InChIKey | HZCPQMUKARJRAC-KCPLEYNQSA-N |
| XLogP | 5.81 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|