C24H44OSi — CID 99772463
tert-butyl-[(1S,4R)-2,4-dimethyl-3-(3-methylbut-3-enyl)-1-pent-4-enylcyclohex-2-en-1-yl]oxy-dimethylsilane (PubChem CID 99772463) has the molecular formula C24H44OSi and a molecular weight of 376.70 g/mol. Its IUPAC name is tert-butyl-[(1S,4R)-2,4-dimethyl-3-(3-methylbut-3-enyl)-1-pent-4-enylcyclohex-2-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1S,4R)-2,4-dimethyl-3-(3-methylbut-3-enyl)-1-pent-4-enylcyclohex-2-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 99772463 |
| Molecular Formula | C24H44OSi |
| Molecular Weight | 376.70 g/mol |
| Exact Mass | 376.32 |
| IUPAC Name | tert-butyl-[(1S,4R)-2,4-dimethyl-3-(3-methylbut-3-enyl)-1-pent-4-enylcyclohex-2-en-1-yl]oxy-dimethylsilane |
| SMILES | C=CCCC[C@]1(O[Si](C)(C)C(C)(C)C)CC[C@@H](C)C(CCC(=C)C)=C1C |
| InChI | InChI=1S/C24H44OSi/c1-11-12-13-17-24(25-26(9,10)23(6,7)8)18-16-20(4)22(21(24)5)15-14-19(2)3/h11,20H,1-2,12-18H2,3-10H3/t20-,24+/m1/s1 |
| InChIKey | IHJVCYKKCDPBPW-YKSBVNFPSA-N |
| XLogP | 8.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.70 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|