C26H50O2Si2 — CID 102475884
tert-butyl-[[6-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl]cyclohexen-1-yl]methoxy]-dimethylsilane (PubChem CID 102475884) has the molecular formula C26H50O2Si2 and a molecular weight of 450.86 g/mol. Its IUPAC name is tert-butyl-[[6-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl]cyclohexen-1-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[6-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl]cyclohexen-1-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 102475884 |
| Molecular Formula | C26H50O2Si2 |
| Molecular Weight | 450.86 g/mol |
| Exact Mass | 450.33 |
| IUPAC Name | tert-butyl-[[6-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl]cyclohexen-1-yl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=CCCCC1C1CCCC=C1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H50O2Si2/c1-25(2,3)29(7,8)27-19-21-15-11-13-17-23(21)24-18-14-12-16-22(24)20-28-30(9,10)26(4,5)6/h15-16,23-24H,11-14,17-20H2,1-10H3 |
| InChIKey | BDAABHGMEKGDHV-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.86 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|