C21H38OSi — CID 134865706
[(1S,4aR,8S)-2,5-dimethyl-8-propan-2-yl-1,4,4a,7,8,8a-hexahydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134865706) has the molecular formula C21H38OSi and a molecular weight of 334.62 g/mol. Its IUPAC name is [(1S,4aR,8S)-2,5-dimethyl-8-propan-2-yl-1,4,4a,7,8,8a-hexahydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,4aR,8S)-2,5-dimethyl-8-propan-2-yl-1,4,4a,7,8,8a-hexahydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134865706 |
| Molecular Formula | C21H38OSi |
| Molecular Weight | 334.62 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | [(1S,4aR,8S)-2,5-dimethyl-8-propan-2-yl-1,4,4a,7,8,8a-hexahydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1=CC[C@H]2C(C)=CCC(C(C)C)C2[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38OSi/c1-14(2)17-12-10-15(3)18-13-11-16(4)20(19(17)18)22-23(8,9)21(5,6)7/h10-11,14,17-20H,12-13H2,1-9H3/t17?,18-,19?,20+/m0/s1 |
| InChIKey | CEKNXWXTVUJVND-ZUPWUQBJSA-N |
| XLogP | 6.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.62 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|