C18H36OSi — CID 135070894
tert-butyl-(5-hexyl-3-methylcyclopent-2-en-1-yl)oxy-dimethylsilane (PubChem CID 135070894) has the molecular formula C18H36OSi and a molecular weight of 296.57 g/mol. Its IUPAC name is tert-butyl-(5-hexyl-3-methylcyclopent-2-en-1-yl)oxy-dimethylsilane.
| Compound Name | tert-butyl-(5-hexyl-3-methylcyclopent-2-en-1-yl)oxy-dimethylsilane |
|---|---|
| PubChem CID | 135070894 |
| Molecular Formula | C18H36OSi |
| Molecular Weight | 296.57 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | tert-butyl-(5-hexyl-3-methylcyclopent-2-en-1-yl)oxy-dimethylsilane |
| SMILES | CCCCCCC1CC(C)=CC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36OSi/c1-8-9-10-11-12-16-13-15(2)14-17(16)19-20(6,7)18(3,4)5/h14,16-17H,8-13H2,1-7H3 |
| InChIKey | LTTAEUMOLNHAQH-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.57 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|