C21H44O2Si — CID 23727931
(3R,7R)-1-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodec-10-en-4-ol (PubChem CID 23727931) has the molecular formula C21H44O2Si and a molecular weight of 356.67 g/mol. Its IUPAC name is (3R,7R)-1-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodec-10-en-4-ol.
| Compound Name | (3R,7R)-1-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodec-10-en-4-ol |
|---|---|
| PubChem CID | 23727931 |
| Molecular Formula | C21H44O2Si |
| Molecular Weight | 356.67 g/mol |
| Exact Mass | 356.31 |
| IUPAC Name | (3R,7R)-1-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodec-10-en-4-ol |
| SMILES | CC(C)=CCC[C@@H](C)CCC(O)[C@H](C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H44O2Si/c1-17(2)11-10-12-18(3)13-14-20(22)19(4)15-16-23-24(8,9)21(5,6)7/h11,18-20,22H,10,12-16H2,1-9H3/t18-,19-,20?/m1/s1 |
| InChIKey | XQEZGIZJZUCNII-LEAGNCFPSA-N |
| XLogP | 6.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.67 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|