C24H45IO2Si — CID 24740596
(1E,3E,5R,6S,7R,8R,9S,11E)-8-[tert-butyl(dimethyl)silyl]oxy-1-iodo-3,5,7,9,11-pentamethyltrideca-1,3,11-trien-6-ol (PubChem CID 24740596) has the molecular formula C24H45IO2Si and a molecular weight of 520.61 g/mol. Its IUPAC name is (1E,3E,5R,6S,7R,8R,9S,11E)-8-[tert-butyl(dimethyl)silyl]oxy-1-iodo-3,5,7,9,11-pentamethyltrideca-1,3,11-trien-6-ol.
| Compound Name | (1E,3E,5R,6S,7R,8R,9S,11E)-8-[tert-butyl(dimethyl)silyl]oxy-1-iodo-3,5,7,9,11-pentamethyltrideca-1,3,11-trien-6-ol |
|---|---|
| PubChem CID | 24740596 |
| Molecular Formula | C24H45IO2Si |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | (1E,3E,5R,6S,7R,8R,9S,11E)-8-[tert-butyl(dimethyl)silyl]oxy-1-iodo-3,5,7,9,11-pentamethyltrideca-1,3,11-trien-6-ol |
| SMILES | C/C=C(\C)C[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](O)[C@H](C)/C=C(C)/C=C/I |
| InChI | InChI=1S/C24H45IO2Si/c1-12-17(2)15-20(5)23(27-28(10,11)24(7,8)9)21(6)22(26)19(4)16-18(3)13-14-25/h12-14,16,19-23,26H,15H2,1-11H3/b14-13+,17-12+,18-16+/t19-,20+,21-,22+,23-/m1/s1 |
| InChIKey | XHODKJFZXHTBLG-RNFQVRMISA-N |
| XLogP | 7.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|