C21H43IO2Si2 — CID 134983131
[(1R,2R,3E,5E)-6-iodo-2,4-dimethyl-1-[(2S,3R,4S)-4-methyl-3-trimethylsilyloxyhexan-2-yl]hexa-3,5-dienoxy]-trimethylsilane (PubChem CID 134983131) has the molecular formula C21H43IO2Si2 and a molecular weight of 510.65 g/mol. Its IUPAC name is [(1R,2R,3E,5E)-6-iodo-2,4-dimethyl-1-[(2S,3R,4S)-4-methyl-3-trimethylsilyloxyhexan-2-yl]hexa-3,5-dienoxy]-trimethylsilane.
| Compound Name | [(1R,2R,3E,5E)-6-iodo-2,4-dimethyl-1-[(2S,3R,4S)-4-methyl-3-trimethylsilyloxyhexan-2-yl]hexa-3,5-dienoxy]-trimethylsilane |
|---|---|
| PubChem CID | 134983131 |
| Molecular Formula | C21H43IO2Si2 |
| Molecular Weight | 510.65 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | [(1R,2R,3E,5E)-6-iodo-2,4-dimethyl-1-[(2S,3R,4S)-4-methyl-3-trimethylsilyloxyhexan-2-yl]hexa-3,5-dienoxy]-trimethylsilane |
| SMILES | CC[C@H](C)[C@@H](O[Si](C)(C)C)[C@H](C)[C@H](O[Si](C)(C)C)[C@H](C)/C=C(C)/C=C/I |
| InChI | InChI=1S/C21H43IO2Si2/c1-12-17(3)20(23-25(6,7)8)19(5)21(24-26(9,10)11)18(4)15-16(2)13-14-22/h13-15,17-21H,12H2,1-11H3/b14-13+,16-15+/t17-,18+,19-,20+,21+/m0/s1 |
| InChIKey | WVZOOZBOGIVMMG-JVPCKDTKSA-N |
| XLogP | 7.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.65 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|