C16H34O2Si2 — CID 68742405
(3,7-dimethyl-8-trimethylsilyloxycyclooct-3-en-1-yl)oxy-trimethylsilane (PubChem CID 68742405) has the molecular formula C16H34O2Si2 and a molecular weight of 314.62 g/mol. Its IUPAC name is (3,7-dimethyl-8-trimethylsilyloxycyclooct-3-en-1-yl)oxy-trimethylsilane.
| Compound Name | (3,7-dimethyl-8-trimethylsilyloxycyclooct-3-en-1-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 68742405 |
| Molecular Formula | C16H34O2Si2 |
| Molecular Weight | 314.62 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | (3,7-dimethyl-8-trimethylsilyloxycyclooct-3-en-1-yl)oxy-trimethylsilane |
| SMILES | CC1=CCCC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1 |
| InChI | InChI=1S/C16H34O2Si2/c1-13-10-9-11-14(2)16(18-20(6,7)8)15(12-13)17-19(3,4)5/h10,14-16H,9,11-12H2,1-8H3 |
| InChIKey | WUOHAAXAXDXVAT-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|